C36H44N6O10 — CID 118510981
[4-[[(2R)-2,5-diamino-2-[(2S)-2-cyclopentyl-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate (PubChem CID 118510981) has the molecular formula C36H44N6O10 and a molecular weight of 720.78 g/mol. Its IUPAC name is [4-[[(2R)-2,5-diamino-2-[(2S)-2-cyclopentyl-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [4-[[(2R)-2,5-diamino-2-[(2S)-2-cyclopentyl-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 118510981 |
| Molecular Formula | C36H44N6O10 |
| Molecular Weight | 720.78 g/mol |
| Exact Mass | 720.31 |
| IUPAC Name | [4-[[(2R)-2,5-diamino-2-[(2S)-2-cyclopentyl-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
| SMILES | NCCC[C@](N)(C(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1)C(=O)[C@@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C1CCCC1 |
| InChI | InChI=1S/C36H44N6O10/c37-21-6-20-36(38,33(46)32(25-7-3-4-8-25)40-29(43)9-2-1-5-22-41-30(44)18-19-31(41)45)34(47)39-26-12-10-24(11-13-26)23-51-35(48)52-28-16-14-27(15-17-28)42(49)50/h10-19,25,32H,1-9,20-23,37-38H2,(H,39,47)(H,40,43)/t32-,36+/m0/s1 |
| InChIKey | LQGLQQKSONDYMI-LBHUVFDKSA-N |
| XLogP | 3.41 |
| TPSA | 243.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|