About morpholine;nitrobenzene
morpholine;nitrobenzene (PubChem CID 118511657) has the molecular formula C10H14N2O3
and a molecular weight of 210.23 g/mol. Its IUPAC name is morpholine;nitrobenzene.
Molecular Properties
| Compound Name | morpholine;nitrobenzene |
| PubChem CID | 118511657 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | morpholine;nitrobenzene |
| SMILES | C1COCCN1.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.C4H9NO/c8-7(9)6-4-2-1-3-5-6;1-3-6-4-2-5-1/h1-5H;5H,1-4H2 |
| InChIKey | VFPBLILFLMGMCD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze morpholine;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine;nitrobenzene?
The IUPAC name of morpholine;nitrobenzene (CID 118511657) is morpholine;nitrobenzene.
What is the SMILES notation for morpholine;nitrobenzene?
The canonical SMILES for morpholine;nitrobenzene is C1COCCN1.O=[N+]([O-])c1ccccc1.
What is the InChIKey of morpholine;nitrobenzene?
The InChIKey is VFPBLILFLMGMCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C4H9NO/c8-7(9)6-4-2-1-3-5-6;1-3-6-4-2-5-1/h1-5H;5H,1-4H2.
What are the key properties of morpholine;nitrobenzene?
morpholine;nitrobenzene has a molecular weight of 210.23 g/mol, XLogP of 1.20, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine;nitrobenzene is sourced from PubChem (CID 118511657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).