About 1,3-bis(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propan-1-ol
1,3-bis(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propan-1-ol (PubChem CID 118511781) has the molecular formula C19H40N2O+2
and a molecular weight of 312.54 g/mol. Its IUPAC name is 1,3-bis(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propan-1-ol.
Molecular Properties
| Compound Name | 1,3-bis(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propan-1-ol |
| PubChem CID | 118511781 |
| Molecular Formula | C19H40N2O+2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.31 |
| IUPAC Name | 1,3-bis(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propan-1-ol |
| SMILES | CC[N+]1(CCC(O)[N+]2(CC)CC(C)C(C)C2)CC(C)C(C)C1 |
| InChI | InChI=1S/C19H40N2O/c1-7-20(11-15(3)16(4)12-20)10-9-19(22)21(8-2)13-17(5)18(6)14-21/h15-19,22H,7-14H2,1-6H3/q+2 |
| InChIKey | WCTMUTAUUNYSTG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propan-1-ol?
The IUPAC name of 1,3-bis(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propan-1-ol (CID 118511781) is 1,3-bis(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propan-1-ol.
What is the SMILES notation for 1,3-bis(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propan-1-ol?
The canonical SMILES for 1,3-bis(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propan-1-ol is CC[N+]1(CCC(O)[N+]2(CC)CC(C)C(C)C2)CC(C)C(C)C1.
What is the InChIKey of 1,3-bis(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propan-1-ol?
The InChIKey is WCTMUTAUUNYSTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40N2O/c1-7-20(11-15(3)16(4)12-20)10-9-19(22)21(8-2)13-17(5)18(6)14-21/h15-19,22H,7-14H2,1-6H3/q+2.
What are the key properties of 1,3-bis(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propan-1-ol?
1,3-bis(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propan-1-ol has a molecular weight of 312.54 g/mol, XLogP of 2.94, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propan-1-ol is sourced from PubChem (CID 118511781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).