C9H21N3 — CID 11851189
N',N'-dimethyl-N-[[(2S)-pyrrolidin-2-yl]methyl]ethane-1,2-diamine (PubChem CID 11851189) has the molecular formula C9H21N3 and a molecular weight of 171.29 g/mol. Its IUPAC name is N',N'-dimethyl-N-[[(2S)-pyrrolidin-2-yl]methyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[[(2S)-pyrrolidin-2-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 11851189 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | N',N'-dimethyl-N-[[(2S)-pyrrolidin-2-yl]methyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNC[C@@H]1CCCN1 |
| InChI | InChI=1S/C9H21N3/c1-12(2)7-6-10-8-9-4-3-5-11-9/h9-11H,3-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | SXJUMWGHRVCRAW-VIFPVBQESA-N |
| XLogP | -0.11 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|