C19H17ClN6O4S3 — CID 118511921
[3-chloro-N-[[5-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-1,3-thiazol-2-yl]carbamoyl]anilino] methanesulfonate (PubChem CID 118511921) has the molecular formula C19H17ClN6O4S3 and a molecular weight of 525.04 g/mol. Its IUPAC name is [3-chloro-N-[[5-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-1,3-thiazol-2-yl]carbamoyl]anilino] methanesulfonate.
| Compound Name | [3-chloro-N-[[5-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-1,3-thiazol-2-yl]carbamoyl]anilino] methanesulfonate |
|---|---|
| PubChem CID | 118511921 |
| Molecular Formula | C19H17ClN6O4S3 |
| Molecular Weight | 525.04 g/mol |
| Exact Mass | 524.02 |
| IUPAC Name | [3-chloro-N-[[5-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-1,3-thiazol-2-yl]carbamoyl]anilino] methanesulfonate |
| SMILES | CS(=O)(=O)ON(C(=O)Nc1ncc(CCNc2ncnc3ccsc23)s1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H17ClN6O4S3/c1-33(28,29)30-26(13-4-2-3-12(20)9-13)19(27)25-18-22-10-14(32-18)5-7-21-17-16-15(6-8-31-16)23-11-24-17/h2-4,6,8-11H,5,7H2,1H3,(H,21,23,24)(H,22,25,27) |
| InChIKey | XVMZGLBIXWVMOI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.04 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|