C26H22F4IN3O2 — CID 118512384
6-[5-fluoro-4-phenylmethoxy-2-(2,2,2-trifluoroethyl)phenyl]-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine (PubChem CID 118512384) has the molecular formula C26H22F4IN3O2 and a molecular weight of 611.38 g/mol. Its IUPAC name is 6-[5-fluoro-4-phenylmethoxy-2-(2,2,2-trifluoroethyl)phenyl]-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine.
| Compound Name | 6-[5-fluoro-4-phenylmethoxy-2-(2,2,2-trifluoroethyl)phenyl]-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 118512384 |
| Molecular Formula | C26H22F4IN3O2 |
| Molecular Weight | 611.38 g/mol |
| Exact Mass | 611.07 |
| IUPAC Name | 6-[5-fluoro-4-phenylmethoxy-2-(2,2,2-trifluoroethyl)phenyl]-3-iodo-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine |
| SMILES | Fc1cc(-c2cc3c(cn2)c(I)nn3C2CCCCO2)c(CC(F)(F)F)cc1OCc1ccccc1 |
| InChI | InChI=1S/C26H22F4IN3O2/c27-20-11-18(17(13-26(28,29)30)10-23(20)36-15-16-6-2-1-3-7-16)21-12-22-19(14-32-21)25(31)33-34(22)24-8-4-5-9-35-24/h1-3,6-7,10-12,14,24H,4-5,8-9,13,15H2 |
| InChIKey | BNNRMXHGUWOBBT-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.38 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|