C14H15BrCl2N2 — CID 118512878
3-(bromomethyl)-1-(2,6-dichlorophenyl)-5-(2-methylpropyl)pyrazole (PubChem CID 118512878) has the molecular formula C14H15BrCl2N2 and a molecular weight of 362.10 g/mol. Its IUPAC name is 3-(bromomethyl)-1-(2,6-dichlorophenyl)-5-(2-methylpropyl)pyrazole.
| Compound Name | 3-(bromomethyl)-1-(2,6-dichlorophenyl)-5-(2-methylpropyl)pyrazole |
|---|---|
| PubChem CID | 118512878 |
| Molecular Formula | C14H15BrCl2N2 |
| Molecular Weight | 362.10 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 3-(bromomethyl)-1-(2,6-dichlorophenyl)-5-(2-methylpropyl)pyrazole |
| SMILES | CC(C)Cc1cc(CBr)nn1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H15BrCl2N2/c1-9(2)6-11-7-10(8-15)18-19(11)14-12(16)4-3-5-13(14)17/h3-5,7,9H,6,8H2,1-2H3 |
| InChIKey | SJEWTPCJLJDNAM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.10 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|