About (2S)-2,6-diamino-1-[9-chloro-10-[(octylamino)methyl]anthracen-1-yl]hexan-1-one
(2S)-2,6-diamino-1-[9-chloro-10-[(octylamino)methyl]anthracen-1-yl]hexan-1-one (PubChem CID 118513380) has the molecular formula C29H40ClN3O
and a molecular weight of 482.11 g/mol. Its IUPAC name is (2S)-2,6-diamino-1-[9-chloro-10-[(octylamino)methyl]anthracen-1-yl]hexan-1-one.
Molecular Properties
| Compound Name | (2S)-2,6-diamino-1-[9-chloro-10-[(octylamino)methyl]anthracen-1-yl]hexan-1-one |
| PubChem CID | 118513380 |
| Molecular Formula | C29H40ClN3O |
| Molecular Weight | 482.11 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | (2S)-2,6-diamino-1-[9-chloro-10-[(octylamino)methyl]anthracen-1-yl]hexan-1-one |
| SMILES | CCCCCCCCNCc1c2ccccc2c(Cl)c2c(C(=O)[C@@H](N)CCCCN)cccc12 |
| InChI | InChI=1S/C29H40ClN3O/c1-2-3-4-5-6-11-19-33-20-25-21-13-7-8-14-23(21)28(30)27-22(25)15-12-16-24(27)29(34)26(32)17-9-10-18-31/h7-8,12-16,26,33H,2-6,9-11,17-20,31-32H2,1H3/t26-/m0/s1 |
| InChIKey | XSYCZVJFFOEIGU-SANMLTNESA-N |
| XLogP | 6.74 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.11 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,6-diamino-1-[9-chloro-10-[(octylamino)methyl]anthracen-1-yl]hexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,6-diamino-1-[9-chloro-10-[(octylamino)methyl]anthracen-1-yl]hexan-1-one?
The IUPAC name of (2S)-2,6-diamino-1-[9-chloro-10-[(octylamino)methyl]anthracen-1-yl]hexan-1-one (CID 118513380) is (2S)-2,6-diamino-1-[9-chloro-10-[(octylamino)methyl]anthracen-1-yl]hexan-1-one.
What is the SMILES notation for (2S)-2,6-diamino-1-[9-chloro-10-[(octylamino)methyl]anthracen-1-yl]hexan-1-one?
The canonical SMILES for (2S)-2,6-diamino-1-[9-chloro-10-[(octylamino)methyl]anthracen-1-yl]hexan-1-one is CCCCCCCCNCc1c2ccccc2c(Cl)c2c(C(=O)[C@@H](N)CCCCN)cccc12.
What is the InChIKey of (2S)-2,6-diamino-1-[9-chloro-10-[(octylamino)methyl]anthracen-1-yl]hexan-1-one?
The InChIKey is XSYCZVJFFOEIGU-SANMLTNESA-N. The full InChI is InChI=1S/C29H40ClN3O/c1-2-3-4-5-6-11-19-33-20-25-21-13-7-8-14-23(21)28(30)27-22(25)15-12-16-24(27)29(34)26(32)17-9-10-18-31/h7-8,12-16,26,33H,2-6,9-11,17-20,31-32H2,1H3/t26-/m0/s1.
What are the key properties of (2S)-2,6-diamino-1-[9-chloro-10-[(octylamino)methyl]anthracen-1-yl]hexan-1-one?
(2S)-2,6-diamino-1-[9-chloro-10-[(octylamino)methyl]anthracen-1-yl]hexan-1-one has a molecular weight of 482.11 g/mol, XLogP of 6.74, 15 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,6-diamino-1-[9-chloro-10-[(octylamino)methyl]anthracen-1-yl]hexan-1-one is sourced from PubChem (CID 118513380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).