C12H20O2 — CID 11851344
(1R,2R,5S,6S)-6-(hydroxymethyl)-2-methyl-6-prop-2-enylbicyclo[3.1.1]heptan-2-ol (PubChem CID 11851344) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (1R,2R,5S,6S)-6-(hydroxymethyl)-2-methyl-6-prop-2-enylbicyclo[3.1.1]heptan-2-ol.
| Compound Name | (1R,2R,5S,6S)-6-(hydroxymethyl)-2-methyl-6-prop-2-enylbicyclo[3.1.1]heptan-2-ol |
|---|---|
| PubChem CID | 11851344 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (1R,2R,5S,6S)-6-(hydroxymethyl)-2-methyl-6-prop-2-enylbicyclo[3.1.1]heptan-2-ol |
| SMILES | C=CC[C@]1(CO)[C@H]2CC[C@@](C)(O)[C@@H]1C2 |
| InChI | InChI=1S/C12H20O2/c1-3-5-12(8-13)9-4-6-11(2,14)10(12)7-9/h3,9-10,13-14H,1,4-8H2,2H3/t9-,10-,11+,12-/m0/s1 |
| InChIKey | OQGOZSLRKCUVNN-YFKTTZPYSA-N |
| XLogP | 1.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|