C17H17F2N3O3S — CID 118513518
[(4S,6R)-4-(2,4-difluorophenyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-methyl-5,6-dihydro-1,3-thiazin-2-yl]carbamic acid (PubChem CID 118513518) has the molecular formula C17H17F2N3O3S and a molecular weight of 381.40 g/mol. Its IUPAC name is [(4S,6R)-4-(2,4-difluorophenyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-methyl-5,6-dihydro-1,3-thiazin-2-yl]carbamic acid.
| Compound Name | [(4S,6R)-4-(2,4-difluorophenyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-methyl-5,6-dihydro-1,3-thiazin-2-yl]carbamic acid |
|---|---|
| PubChem CID | 118513518 |
| Molecular Formula | C17H17F2N3O3S |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | [(4S,6R)-4-(2,4-difluorophenyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-methyl-5,6-dihydro-1,3-thiazin-2-yl]carbamic acid |
| SMILES | Cc1noc(C)c1[C@H]1C[C@@](C)(c2ccc(F)cc2F)N=C(NC(=O)O)S1 |
| InChI | InChI=1S/C17H17F2N3O3S/c1-8-14(9(2)25-22-8)13-7-17(3,21-15(26-13)20-16(23)24)11-5-4-10(18)6-12(11)19/h4-6,13H,7H2,1-3H3,(H,20,21)(H,23,24)/t13-,17+/m1/s1 |
| InChIKey | XBZHBABBYQBEFV-DYVFJYSZSA-N |
| XLogP | 4.29 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |