C18H19F2N3O2S — CID 118513519
1-[5-[(4R,6S)-2-amino-6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-methyl-5,6-dihydro-1,3-thiazin-4-yl]-2,4-difluorophenyl]ethanone (PubChem CID 118513519) has the molecular formula C18H19F2N3O2S and a molecular weight of 379.43 g/mol. Its IUPAC name is 1-[5-[(4R,6S)-2-amino-6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-methyl-5,6-dihydro-1,3-thiazin-4-yl]-2,4-difluorophenyl]ethanone.
| Compound Name | 1-[5-[(4R,6S)-2-amino-6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-methyl-5,6-dihydro-1,3-thiazin-4-yl]-2,4-difluorophenyl]ethanone |
|---|---|
| PubChem CID | 118513519 |
| Molecular Formula | C18H19F2N3O2S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-[5-[(4R,6S)-2-amino-6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-methyl-5,6-dihydro-1,3-thiazin-4-yl]-2,4-difluorophenyl]ethanone |
| SMILES | CC(=O)c1cc([C@@]2(C)C[C@@H](c3c(C)noc3C)SC(N)=N2)c(F)cc1F |
| InChI | InChI=1S/C18H19F2N3O2S/c1-8-16(10(3)25-23-8)15-7-18(4,22-17(21)26-15)12-5-11(9(2)24)13(19)6-14(12)20/h5-6,15H,7H2,1-4H3,(H2,21,22)/t15-,18+/m0/s1 |
| InChIKey | AKGDKQQWPWDRTR-MAUKXSAKSA-N |
| XLogP | 4.18 |
| TPSA | 81.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |