About [3-(1,3-dioxolan-4-yl)-2,2-dimethylcyclopropyl]methanol
[3-(1,3-dioxolan-4-yl)-2,2-dimethylcyclopropyl]methanol (PubChem CID 118513585) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is [3-(1,3-dioxolan-4-yl)-2,2-dimethylcyclopropyl]methanol.
Molecular Properties
| Compound Name | [3-(1,3-dioxolan-4-yl)-2,2-dimethylcyclopropyl]methanol |
| PubChem CID | 118513585 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | [3-(1,3-dioxolan-4-yl)-2,2-dimethylcyclopropyl]methanol |
| SMILES | CC1(C)C(CO)C1C1COCO1 |
| InChI | InChI=1S/C9H16O3/c1-9(2)6(3-10)8(9)7-4-11-5-12-7/h6-8,10H,3-5H2,1-2H3 |
| InChIKey | IHDDASCYTUWPMY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(1,3-dioxolan-4-yl)-2,2-dimethylcyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,3-dioxolan-4-yl)-2,2-dimethylcyclopropyl]methanol?
The IUPAC name of [3-(1,3-dioxolan-4-yl)-2,2-dimethylcyclopropyl]methanol (CID 118513585) is [3-(1,3-dioxolan-4-yl)-2,2-dimethylcyclopropyl]methanol.
What is the SMILES notation for [3-(1,3-dioxolan-4-yl)-2,2-dimethylcyclopropyl]methanol?
The canonical SMILES for [3-(1,3-dioxolan-4-yl)-2,2-dimethylcyclopropyl]methanol is CC1(C)C(CO)C1C1COCO1.
What is the InChIKey of [3-(1,3-dioxolan-4-yl)-2,2-dimethylcyclopropyl]methanol?
The InChIKey is IHDDASCYTUWPMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-9(2)6(3-10)8(9)7-4-11-5-12-7/h6-8,10H,3-5H2,1-2H3.
What are the key properties of [3-(1,3-dioxolan-4-yl)-2,2-dimethylcyclopropyl]methanol?
[3-(1,3-dioxolan-4-yl)-2,2-dimethylcyclopropyl]methanol has a molecular weight of 172.22 g/mol, XLogP of 0.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,3-dioxolan-4-yl)-2,2-dimethylcyclopropyl]methanol is sourced from PubChem (CID 118513585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).