C25H24N2O4 — CID 118513805
6-(4-methoxyphenyl)-2-oxo-N-(4-phenylbutyl)-1,3-benzoxazole-3-carboxamide (PubChem CID 118513805) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-2-oxo-N-(4-phenylbutyl)-1,3-benzoxazole-3-carboxamide.
| Compound Name | 6-(4-methoxyphenyl)-2-oxo-N-(4-phenylbutyl)-1,3-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 118513805 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 6-(4-methoxyphenyl)-2-oxo-N-(4-phenylbutyl)-1,3-benzoxazole-3-carboxamide |
| SMILES | COc1ccc(-c2ccc3c(c2)oc(=O)n3C(=O)NCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N2O4/c1-30-21-13-10-19(11-14-21)20-12-15-22-23(17-20)31-25(29)27(22)24(28)26-16-6-5-9-18-7-3-2-4-8-18/h2-4,7-8,10-15,17H,5-6,9,16H2,1H3,(H,26,28) |
| InChIKey | IRGZDLYISPWHSN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|