C52H44F6N12O8S2 — CID 118514053
2,3-bis[4-[methyl-[2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]phenyl]-N,N'-bis[4-(trifluoromethoxy)phenyl]butanediamide (PubChem CID 118514053) has the molecular formula C52H44F6N12O8S2 and a molecular weight of 1143.12 g/mol. Its IUPAC name is 2,3-bis[4-[methyl-[2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]phenyl]-N,N'-bis[4-(trifluoromethoxy)phenyl]butanediamide.
| Compound Name | 2,3-bis[4-[methyl-[2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]phenyl]-N,N'-bis[4-(trifluoromethoxy)phenyl]butanediamide |
|---|---|
| PubChem CID | 118514053 |
| Molecular Formula | C52H44F6N12O8S2 |
| Molecular Weight | 1143.12 g/mol |
| Exact Mass | 1142.28 |
| IUPAC Name | 2,3-bis[4-[methyl-[2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]phenyl]-N,N'-bis[4-(trifluoromethoxy)phenyl]butanediamide |
| SMILES | CN(c1ccc(C(C(=O)Nc2ccc(OC(F)(F)F)cc2)C(C(=O)Nc2ccc(OC(F)(F)F)cc2)c2ccc(N(C)c3ccnc(Nc4cccc(S(N)(=O)=O)c4)n3)cc2)cc1)c1ccnc(Nc2cccc(S(N)(=O)=O)c2)n1 |
| InChI | InChI=1S/C52H44F6N12O8S2/c1-69(43-25-27-61-49(67-43)65-35-5-3-7-41(29-35)79(59,73)74)37-17-9-31(10-18-37)45(47(71)63-33-13-21-39(22-14-33)77-51(53,54)55)46(48(72)64-34-15-23-40(24-16-34)78-52(56,57)58)32-11-19-38(20-12-32)70(2)44-26-28-62-50(68-44)66-36-6-4-8-42(30-36)80(60,75)76/h3-30,45-46H,1-2H3,(H,63,71)(H,64,72)(H2,59,73,74)(H2,60,75,76)(H,61,65,67)(H,62,66,68) |
| InChIKey | KKELJWSDHFSZAH-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 279.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 80 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1143.12 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |