C52H51FN4O7 — CID 118514372
7-(4-fluorophenyl)-2-oxo-N-(6-phenylhexyl)-1,3-benzoxazole-3-carboxamide;7-(4-methoxyphenyl)-2-oxo-N-(5-phenylpentyl)-1,3-benzoxazole-3-carboxamide (PubChem CID 118514372) has the molecular formula C52H51FN4O7 and a molecular weight of 863.00 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-2-oxo-N-(6-phenylhexyl)-1,3-benzoxazole-3-carboxamide;7-(4-methoxyphenyl)-2-oxo-N-(5-phenylpentyl)-1,3-benzoxazole-3-carboxamide.
| Compound Name | 7-(4-fluorophenyl)-2-oxo-N-(6-phenylhexyl)-1,3-benzoxazole-3-carboxamide;7-(4-methoxyphenyl)-2-oxo-N-(5-phenylpentyl)-1,3-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 118514372 |
| Molecular Formula | C52H51FN4O7 |
| Molecular Weight | 863.00 g/mol |
| Exact Mass | 862.37 |
| IUPAC Name | 7-(4-fluorophenyl)-2-oxo-N-(6-phenylhexyl)-1,3-benzoxazole-3-carboxamide;7-(4-methoxyphenyl)-2-oxo-N-(5-phenylpentyl)-1,3-benzoxazole-3-carboxamide |
| SMILES | COc1ccc(-c2cccc3c2oc(=O)n3C(=O)NCCCCCc2ccccc2)cc1.O=C(NCCCCCCc1ccccc1)n1c(=O)oc2c(-c3ccc(F)cc3)cccc21 |
| InChI | InChI=1S/C26H25FN2O3.C26H26N2O4/c27-21-16-14-20(15-17-21)22-12-8-13-23-24(22)32-26(31)29(23)25(30)28-18-7-2-1-4-9-19-10-5-3-6-11-19;1-31-21-16-14-20(15-17-21)22-12-8-13-23-24(22)32-26(30)28(23)25(29)27-18-7-3-6-11-19-9-4-2-5-10-19/h3,5-6,8,10-17H,1-2,4,7,9,18H2,(H,28,30);2,4-5,8-10,12-17H,3,6-7,11,18H2,1H3,(H,27,29) |
| InChIKey | BOPMXCWPTYCVJH-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.00 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|