C18H23N3OS — CID 118514531
N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]azepane-1-carboxamide (PubChem CID 118514531) has the molecular formula C18H23N3OS and a molecular weight of 329.50 g/mol. Its IUPAC name is N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]azepane-1-carboxamide.
| Compound Name | N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 118514531 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.50 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]azepane-1-carboxamide |
| SMILES | C1CCCN(CC1)C(=O)NCCC2=CSC(=N2)C3=CC=CC=C3 |
| InChI | InChI=1S/C18H23N3OS/c22-18(21-12-6-1-2-7-13-21)19-11-10-16-14-23-17(20-16)15-8-4-3-5-9-15/h3-5,8-9,14H,1-2,6-7,10-13H2,(H,19,22) |
| InChIKey | OPJATRBUYSDTIX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | 365 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |