About tert-butyl 6-(4-methylpiperazin-1-yl)-2-azaspiro[3.3]heptane-2-carboxylate;1-methylpiperazine
tert-butyl 6-(4-methylpiperazin-1-yl)-2-azaspiro[3.3]heptane-2-carboxylate;1-methylpiperazine (PubChem CID 118514576) has the molecular formula C21H41N5O2
and a molecular weight of 395.59 g/mol. Its IUPAC name is tert-butyl 6-(4-methylpiperazin-1-yl)-2-azaspiro[3.3]heptane-2-carboxylate;1-methylpiperazine.
Molecular Properties
| Compound Name | tert-butyl 6-(4-methylpiperazin-1-yl)-2-azaspiro[3.3]heptane-2-carboxylate;1-methylpiperazine |
| PubChem CID | 118514576 |
| Molecular Formula | C21H41N5O2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.33 |
| IUPAC Name | tert-butyl 6-(4-methylpiperazin-1-yl)-2-azaspiro[3.3]heptane-2-carboxylate;1-methylpiperazine |
| SMILES | CN1CCN(C2CC3(C2)CN(C(=O)OC(C)(C)C)C3)CC1.CN1CCNCC1 |
| InChI | InChI=1S/C16H29N3O2.C5H12N2/c1-15(2,3)21-14(20)19-11-16(12-19)9-13(10-16)18-7-5-17(4)6-8-18;1-7-4-2-6-3-5-7/h13H,5-12H2,1-4H3;6H,2-5H2,1H3 |
| InChIKey | UKHPHWFIHNLRIN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 51.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 6-(4-methylpiperazin-1-yl)-2-azaspiro[3.3]heptane-2-carboxylate;1-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-(4-methylpiperazin-1-yl)-2-azaspiro[3.3]heptane-2-carboxylate;1-methylpiperazine?
The IUPAC name of tert-butyl 6-(4-methylpiperazin-1-yl)-2-azaspiro[3.3]heptane-2-carboxylate;1-methylpiperazine (CID 118514576) is tert-butyl 6-(4-methylpiperazin-1-yl)-2-azaspiro[3.3]heptane-2-carboxylate;1-methylpiperazine.
What is the SMILES notation for tert-butyl 6-(4-methylpiperazin-1-yl)-2-azaspiro[3.3]heptane-2-carboxylate;1-methylpiperazine?
The canonical SMILES for tert-butyl 6-(4-methylpiperazin-1-yl)-2-azaspiro[3.3]heptane-2-carboxylate;1-methylpiperazine is CN1CCN(C2CC3(C2)CN(C(=O)OC(C)(C)C)C3)CC1.CN1CCNCC1.
What is the InChIKey of tert-butyl 6-(4-methylpiperazin-1-yl)-2-azaspiro[3.3]heptane-2-carboxylate;1-methylpiperazine?
The InChIKey is UKHPHWFIHNLRIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N3O2.C5H12N2/c1-15(2,3)21-14(20)19-11-16(12-19)9-13(10-16)18-7-5-17(4)6-8-18;1-7-4-2-6-3-5-7/h13H,5-12H2,1-4H3;6H,2-5H2,1H3.
What are the key properties of tert-butyl 6-(4-methylpiperazin-1-yl)-2-azaspiro[3.3]heptane-2-carboxylate;1-methylpiperazine?
tert-butyl 6-(4-methylpiperazin-1-yl)-2-azaspiro[3.3]heptane-2-carboxylate;1-methylpiperazine has a molecular weight of 395.59 g/mol, XLogP of 1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-(4-methylpiperazin-1-yl)-2-azaspiro[3.3]heptane-2-carboxylate;1-methylpiperazine is sourced from PubChem (CID 118514576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).