C26H34N6 — CID 11851568
(3R)-1-[2-[[(4aR,10bS)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]imidazo[1,2-a]pyridin-5-yl]-N,N-dimethylpyrrolidin-3-amine (PubChem CID 11851568) has the molecular formula C26H34N6 and a molecular weight of 430.60 g/mol. Its IUPAC name is (3R)-1-[2-[[(4aR,10bS)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]imidazo[1,2-a]pyridin-5-yl]-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | (3R)-1-[2-[[(4aR,10bS)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]imidazo[1,2-a]pyridin-5-yl]-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 11851568 |
| Molecular Formula | C26H34N6 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | (3R)-1-[2-[[(4aR,10bS)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]imidazo[1,2-a]pyridin-5-yl]-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CN(C)[C@@H]1CCN(c2cccc3nc(CN4CCC[C@H]5CCc6cccnc6[C@H]54)cn23)C1 |
| InChI | InChI=1S/C26H34N6/c1-29(2)22-12-15-30(18-22)24-9-3-8-23-28-21(17-32(23)24)16-31-14-5-7-20-11-10-19-6-4-13-27-25(19)26(20)31/h3-4,6,8-9,13,17,20,22,26H,5,7,10-12,14-16,18H2,1-2H3/t20-,22+,26-/m0/s1 |
| InChIKey | AUTULOUVQMXQFP-HXAGEGRHSA-N |
| XLogP | 3.77 |
| TPSA | 39.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |