C16H30O3 — CID 118515772
11,15,15-trimethyl-1,8-dioxacyclopentadecan-9-one (PubChem CID 118515772) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is 11,15,15-trimethyl-1,8-dioxacyclopentadecan-9-one.
| Compound Name | 11,15,15-trimethyl-1,8-dioxacyclopentadecan-9-one |
|---|---|
| PubChem CID | 118515772 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 11,15,15-trimethyl-1,8-dioxacyclopentadecan-9-one |
| SMILES | CC1CCCC(C)(C)OCCCCCCOC(=O)C1 |
| InChI | InChI=1S/C16H30O3/c1-14-9-8-10-16(2,3)19-12-7-5-4-6-11-18-15(17)13-14/h14H,4-13H2,1-3H3 |
| InChIKey | SNHBRZOVHNHPOP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |