C24H24FN3O2 — CID 118515943
3-[3-ethyl-2-[(3-fluoro-2-pyridinyl)-hydroxy-phenylmethyl]benzimidazol-5-yl]propan-1-ol (PubChem CID 118515943) has the molecular formula C24H24FN3O2 and a molecular weight of 405.47 g/mol. Its IUPAC name is 3-[3-ethyl-2-[(3-fluoro-2-pyridinyl)-hydroxy-phenylmethyl]benzimidazol-5-yl]propan-1-ol.
| Compound Name | 3-[3-ethyl-2-[(3-fluoro-2-pyridinyl)-hydroxy-phenylmethyl]benzimidazol-5-yl]propan-1-ol |
|---|---|
| PubChem CID | 118515943 |
| Molecular Formula | C24H24FN3O2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 3-[3-ethyl-2-[(3-fluoro-2-pyridinyl)-hydroxy-phenylmethyl]benzimidazol-5-yl]propan-1-ol |
| SMILES | CCn1c(C(O)(c2ccccc2)c2ncccc2F)nc2ccc(CCCO)cc21 |
| InChI | InChI=1S/C24H24FN3O2/c1-2-28-21-16-17(8-7-15-29)12-13-20(21)27-23(28)24(30,18-9-4-3-5-10-18)22-19(25)11-6-14-26-22/h3-6,9-14,16,29-30H,2,7-8,15H2,1H3 |
| InChIKey | XPCJBGYYJHUGSC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |