About 5-(2,2-dimethylpropyl)-2-(trifluoromethyl)-1,3-thiazole
5-(2,2-dimethylpropyl)-2-(trifluoromethyl)-1,3-thiazole (PubChem CID 118516102) has the molecular formula C9H12F3NS
and a molecular weight of 223.26 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)-2-(trifluoromethyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 5-(2,2-dimethylpropyl)-2-(trifluoromethyl)-1,3-thiazole |
| PubChem CID | 118516102 |
| Molecular Formula | C9H12F3NS |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 5-(2,2-dimethylpropyl)-2-(trifluoromethyl)-1,3-thiazole |
| SMILES | CC(C)(C)Cc1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H12F3NS/c1-8(2,3)4-6-5-13-7(14-6)9(10,11)12/h5H,4H2,1-3H3 |
| InChIKey | UNXJZGRFRGYCSG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,2-dimethylpropyl)-2-(trifluoromethyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dimethylpropyl)-2-(trifluoromethyl)-1,3-thiazole?
The IUPAC name of 5-(2,2-dimethylpropyl)-2-(trifluoromethyl)-1,3-thiazole (CID 118516102) is 5-(2,2-dimethylpropyl)-2-(trifluoromethyl)-1,3-thiazole.
What is the SMILES notation for 5-(2,2-dimethylpropyl)-2-(trifluoromethyl)-1,3-thiazole?
The canonical SMILES for 5-(2,2-dimethylpropyl)-2-(trifluoromethyl)-1,3-thiazole is CC(C)(C)Cc1cnc(C(F)(F)F)s1.
What is the InChIKey of 5-(2,2-dimethylpropyl)-2-(trifluoromethyl)-1,3-thiazole?
The InChIKey is UNXJZGRFRGYCSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3NS/c1-8(2,3)4-6-5-13-7(14-6)9(10,11)12/h5H,4H2,1-3H3.
What are the key properties of 5-(2,2-dimethylpropyl)-2-(trifluoromethyl)-1,3-thiazole?
5-(2,2-dimethylpropyl)-2-(trifluoromethyl)-1,3-thiazole has a molecular weight of 223.26 g/mol, XLogP of 3.75, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dimethylpropyl)-2-(trifluoromethyl)-1,3-thiazole is sourced from PubChem (CID 118516102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).