C26H25BrO6 — CID 118516367
9-bromo-4,6,12,14-tetramethoxy-10-(4-methoxyphenyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one (PubChem CID 118516367) has the molecular formula C26H25BrO6 and a molecular weight of 513.38 g/mol. Its IUPAC name is 9-bromo-4,6,12,14-tetramethoxy-10-(4-methoxyphenyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one.
| Compound Name | 9-bromo-4,6,12,14-tetramethoxy-10-(4-methoxyphenyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
|---|---|
| PubChem CID | 118516367 |
| Molecular Formula | C26H25BrO6 |
| Molecular Weight | 513.38 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | 9-bromo-4,6,12,14-tetramethoxy-10-(4-methoxyphenyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
| SMILES | COc1ccc(C2c3c(OC)cc(OC)cc3C(=O)c3c(OC)cc(OC)cc3C2Br)cc1 |
| InChI | InChI=1S/C26H25BrO6/c1-29-15-8-6-14(7-9-15)22-23-19(11-17(31-3)12-20(23)32-4)26(28)24-18(25(22)27)10-16(30-2)13-21(24)33-5/h6-13,22,25H,1-5H3 |
| InChIKey | UHWZEILGPMRFBT-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.38 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|