C28H20O3 — CID 118516377
(2E)-2-benzylidene-4,6-dihydroxy-10-phenyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one (PubChem CID 118516377) has the molecular formula C28H20O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is (2E)-2-benzylidene-4,6-dihydroxy-10-phenyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one.
| Compound Name | (2E)-2-benzylidene-4,6-dihydroxy-10-phenyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one |
|---|---|
| PubChem CID | 118516377 |
| Molecular Formula | C28H20O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (2E)-2-benzylidene-4,6-dihydroxy-10-phenyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one |
| SMILES | O=C1c2cc(O)cc(O)c2/C(=C/c2ccccc2)c2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C28H20O3/c29-20-16-24-27(25(30)17-20)23(15-18-9-3-1-4-10-18)21-13-7-8-14-22(21)26(28(24)31)19-11-5-2-6-12-19/h1-17,26,29-30H/b23-15+ |
| InChIKey | WHTDFRGVORPIMX-HZHRSRAPSA-N |
| XLogP | 6.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|