About (E)-1,2-diiodopent-2-ene
(E)-1,2-diiodopent-2-ene (PubChem CID 118516393) has the molecular formula C5H8I2
and a molecular weight of 321.93 g/mol. Its IUPAC name is (E)-1,2-diiodopent-2-ene.
Molecular Properties
| Compound Name | (E)-1,2-diiodopent-2-ene |
| PubChem CID | 118516393 |
| Molecular Formula | C5H8I2 |
| Molecular Weight | 321.93 g/mol |
| Exact Mass | 321.87 |
| IUPAC Name | (E)-1,2-diiodopent-2-ene |
| SMILES | CC/C=C(/I)CI |
| InChI | InChI=1S/C5H8I2/c1-2-3-5(7)4-6/h3H,2,4H2,1H3/b5-3+ |
| InChIKey | YOEVWHFUCAYVHE-HWKANZROSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.93 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,2-diiodopent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,2-diiodopent-2-ene?
The IUPAC name of (E)-1,2-diiodopent-2-ene (CID 118516393) is (E)-1,2-diiodopent-2-ene.
What is the SMILES notation for (E)-1,2-diiodopent-2-ene?
The canonical SMILES for (E)-1,2-diiodopent-2-ene is CC/C=C(/I)CI.
What is the InChIKey of (E)-1,2-diiodopent-2-ene?
The InChIKey is YOEVWHFUCAYVHE-HWKANZROSA-N. The full InChI is InChI=1S/C5H8I2/c1-2-3-5(7)4-6/h3H,2,4H2,1H3/b5-3+.
What are the key properties of (E)-1,2-diiodopent-2-ene?
(E)-1,2-diiodopent-2-ene has a molecular weight of 321.93 g/mol, XLogP of 3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,2-diiodopent-2-ene is sourced from PubChem (CID 118516393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).