C36H22N12O — CID 118516424
2-[3-[2-[2-[3,5-bis(1,3,5-triazin-2-yl)phenyl]phenoxy]phenyl]-5-(1,3,5-triazin-2-yl)phenyl]-1,3,5-triazine (PubChem CID 118516424) has the molecular formula C36H22N12O and a molecular weight of 638.66 g/mol. Its IUPAC name is 2-[3-[2-[2-[3,5-bis(1,3,5-triazin-2-yl)phenyl]phenoxy]phenyl]-5-(1,3,5-triazin-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-[3-[2-[2-[3,5-bis(1,3,5-triazin-2-yl)phenyl]phenoxy]phenyl]-5-(1,3,5-triazin-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 118516424 |
| Molecular Formula | C36H22N12O |
| Molecular Weight | 638.66 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | 2-[3-[2-[2-[3,5-bis(1,3,5-triazin-2-yl)phenyl]phenoxy]phenyl]-5-(1,3,5-triazin-2-yl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3ncncn3)cc(-c3ncncn3)c2)c(Oc2ccccc2-c2cc(-c3ncncn3)cc(-c3ncncn3)c2)c1 |
| InChI | InChI=1S/C36H22N12O/c1-3-7-31(29(5-1)23-9-25(33-41-15-37-16-42-33)13-26(10-23)34-43-17-38-18-44-34)49-32-8-4-2-6-30(32)24-11-27(35-45-19-39-20-46-35)14-28(12-24)36-47-21-40-22-48-36/h1-22H |
| InChIKey | WNFYNVUAUOFQNB-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 163.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.66 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |