C55H36N6O — CID 118516495
bis[2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]methanone (PubChem CID 118516495) has the molecular formula C55H36N6O and a molecular weight of 796.93 g/mol. Its IUPAC name is bis[2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]methanone.
| Compound Name | bis[2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 118516495 |
| Molecular Formula | C55H36N6O |
| Molecular Weight | 796.93 g/mol |
| Exact Mass | 796.30 |
| IUPAC Name | bis[2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]methanone |
| SMILES | O=C(c1ccccc1-c1cccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1)c1ccccc1-c1cccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C55H36N6O/c62-49(47-33-15-13-31-45(47)41-27-17-29-43(35-41)54-58-50(37-19-5-1-6-20-37)56-51(59-54)38-21-7-2-8-22-38)48-34-16-14-32-46(48)42-28-18-30-44(36-42)55-60-52(39-23-9-3-10-24-39)57-53(61-55)40-25-11-4-12-26-40/h1-36H |
| InChIKey | WVMKIEBKDUPBSM-UHFFFAOYSA-N |
| XLogP | 12.62 |
| TPSA | 94.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.93 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |