C16H12O2 — CID 118516621
1,2,6,7-tetrahydroindeno[7,6-g]indene-3,8-dione (PubChem CID 118516621) has the molecular formula C16H12O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1,2,6,7-tetrahydroindeno[7,6-g]indene-3,8-dione.
| Compound Name | 1,2,6,7-tetrahydroindeno[7,6-g]indene-3,8-dione |
|---|---|
| PubChem CID | 118516621 |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1,2,6,7-tetrahydroindeno[7,6-g]indene-3,8-dione |
| SMILES | O=C1CCc2ccc3c4c(ccc3c21)CCC4=O |
| InChI | InChI=1S/C16H12O2/c17-13-7-3-9-1-5-11-12(15(9)13)6-2-10-4-8-14(18)16(10)11/h1-2,5-6H,3-4,7-8H2 |
| InChIKey | VQZIHAAPSADCRK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |