C48H34Br2S2 — CID 118516625
6,17-dibromo-3,3,14,14-tetrakis(4-methylphenyl)-7,18-dithiahexacyclo[10.10.0.02,9.04,8.013,20.015,19]docosa-1(12),2(9),4(8),5,10,13(20),15(19),16,21-nonaene (PubChem CID 118516625) has the molecular formula C48H34Br2S2 and a molecular weight of 834.74 g/mol. Its IUPAC name is 6,17-dibromo-3,3,14,14-tetrakis(4-methylphenyl)-7,18-dithiahexacyclo[10.10.0.02,9.04,8.013,20.015,19]docosa-1(12),2(9),4(8),5,10,13(20),15(19),16,21-nonaene.
| Compound Name | 6,17-dibromo-3,3,14,14-tetrakis(4-methylphenyl)-7,18-dithiahexacyclo[10.10.0.02,9.04,8.013,20.015,19]docosa-1(12),2(9),4(8),5,10,13(20),15(19),16,21-nonaene |
|---|---|
| PubChem CID | 118516625 |
| Molecular Formula | C48H34Br2S2 |
| Molecular Weight | 834.74 g/mol |
| Exact Mass | 832.05 |
| IUPAC Name | 6,17-dibromo-3,3,14,14-tetrakis(4-methylphenyl)-7,18-dithiahexacyclo[10.10.0.02,9.04,8.013,20.015,19]docosa-1(12),2(9),4(8),5,10,13(20),15(19),16,21-nonaene |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3)c3cc(Br)sc3-c3ccc4c5c(ccc4c32)-c2sc(Br)cc2C5(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C48H34Br2S2/c1-27-5-13-31(14-6-27)47(32-15-7-28(2)8-16-32)39-25-41(49)51-45(39)37-23-22-36-35(43(37)47)21-24-38-44(36)48(33-17-9-29(3)10-18-33,34-19-11-30(4)12-20-34)40-26-42(50)52-46(38)40/h5-26H,1-4H3 |
| InChIKey | JKSJTNXHVRTLTP-UHFFFAOYSA-N |
| XLogP | 14.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.74 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |