C56H34N6O — CID 118517062
4,12-bis[9-(3-phenylphenyl)pyrido[2,3-b]indol-7-yl]-8-oxa-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 118517062) has the molecular formula C56H34N6O and a molecular weight of 806.93 g/mol. Its IUPAC name is 4,12-bis[9-(3-phenylphenyl)pyrido[2,3-b]indol-7-yl]-8-oxa-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 4,12-bis[9-(3-phenylphenyl)pyrido[2,3-b]indol-7-yl]-8-oxa-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 118517062 |
| Molecular Formula | C56H34N6O |
| Molecular Weight | 806.93 g/mol |
| Exact Mass | 806.28 |
| IUPAC Name | 4,12-bis[9-(3-phenylphenyl)pyrido[2,3-b]indol-7-yl]-8-oxa-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | c1ccc(-c2cccc(-n3c4cc(-c5ccc6oc7ccc(-c8ccc9c%10cccnc%10n(-c%10cccc(-c%11ccccc%11)c%10)c9c8)nc7c6n5)ccc4c4cccnc43)c2)cc1 |
| InChI | InChI=1S/C56H34N6O/c1-3-11-35(12-4-1)37-15-7-17-41(31-37)61-49-33-39(21-23-43(49)45-19-9-29-57-55(45)61)47-25-27-51-53(59-47)54-52(63-51)28-26-48(60-54)40-22-24-44-46-20-10-30-58-56(46)62(50(44)34-40)42-18-8-16-38(32-42)36-13-5-2-6-14-36/h1-34H |
| InChIKey | YODLQIXXWJNVPH-UHFFFAOYSA-N |
| XLogP | 14.03 |
| TPSA | 74.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.93 |
| LogP ≤ 5 | 14.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |