C40H22N10O — CID 118517151
4,12-bis(5-phenyl-[1,2,4]triazino[5,6-b]indol-7-yl)-8-oxa-5,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 118517151) has the molecular formula C40H22N10O and a molecular weight of 658.69 g/mol. Its IUPAC name is 4,12-bis(5-phenyl-[1,2,4]triazino[5,6-b]indol-7-yl)-8-oxa-5,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 4,12-bis(5-phenyl-[1,2,4]triazino[5,6-b]indol-7-yl)-8-oxa-5,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 118517151 |
| Molecular Formula | C40H22N10O |
| Molecular Weight | 658.69 g/mol |
| Exact Mass | 658.20 |
| IUPAC Name | 4,12-bis(5-phenyl-[1,2,4]triazino[5,6-b]indol-7-yl)-8-oxa-5,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | c1ccc(-n2c3cc(-c4cc5c(cn4)oc4cnc(-c6ccc7c8nncnc8n(-c8ccccc8)c7c6)cc45)ccc3c3nncnc32)cc1 |
| InChI | InChI=1S/C40H22N10O/c1-3-7-25(8-4-1)49-33-15-23(11-13-27(33)37-39(49)43-21-45-47-37)31-17-29-30-18-32(42-20-36(30)51-35(29)19-41-31)24-12-14-28-34(16-24)50(26-9-5-2-6-10-26)40-38(28)48-46-22-44-40/h1-22H |
| InChIKey | OVSJLRLUTYKMBX-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 126.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.69 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |