C8H16O5S — CID 118517375
3-(2,2-Dimethylpropanoyloxy)propane-1-sulfonic acid (PubChem CID 118517375) has the molecular formula C8H16O5S and a molecular weight of 224.28 g/mol. Its IUPAC name is 3-(2,2-dimethylpropanoyloxy)propane-1-sulfonic acid.
| Compound Name | 3-(2,2-Dimethylpropanoyloxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 118517375 |
| Molecular Formula | C8H16O5S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 3-(2,2-dimethylpropanoyloxy)propane-1-sulfonic acid |
| SMILES | CC(C)(C)C(=O)OCCCS(=O)(=O)O |
| InChI | InChI=1S/C8H16O5S/c1-8(2,3)7(9)13-5-4-6-14(10,11)12/h4-6H2,1-3H3,(H,10,11,12) |
| InChIKey | BXNSSPITLPYUQL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | 280 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|