C24H25FO4 — CID 118517483
4-[2-[(1R,2R)-2-[(E)-4-(2-fluorophenyl)-3-hydroxybut-1-enyl]-5-oxocyclopentyl]ethyl]benzoic acid (PubChem CID 118517483) has the molecular formula C24H25FO4 and a molecular weight of 396.46 g/mol. Its IUPAC name is 4-[2-[(1R,2R)-2-[(E)-4-(2-fluorophenyl)-3-hydroxybut-1-enyl]-5-oxocyclopentyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(1R,2R)-2-[(E)-4-(2-fluorophenyl)-3-hydroxybut-1-enyl]-5-oxocyclopentyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 118517483 |
| Molecular Formula | C24H25FO4 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 4-[2-[(1R,2R)-2-[(E)-4-(2-fluorophenyl)-3-hydroxybut-1-enyl]-5-oxocyclopentyl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CC[C@H]2C(=O)CC[C@@H]2/C=C/C(O)Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C24H25FO4/c25-22-4-2-1-3-19(22)15-20(26)12-10-17-11-14-23(27)21(17)13-7-16-5-8-18(9-6-16)24(28)29/h1-6,8-10,12,17,20-21,26H,7,11,13-15H2,(H,28,29)/b12-10+/t17-,20?,21+/m0/s1 |
| InChIKey | ABNHKWJQNLIOML-YILGNFQOSA-N |
| XLogP | 4.21 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|