C17H30O3 — CID 118517716
(4S,5E,7S,8R,9E)-7-ethyl-8-(methoxymethoxy)-5,9-dimethylundeca-1,5,9-trien-4-ol (PubChem CID 118517716) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (4S,5E,7S,8R,9E)-7-ethyl-8-(methoxymethoxy)-5,9-dimethylundeca-1,5,9-trien-4-ol.
| Compound Name | (4S,5E,7S,8R,9E)-7-ethyl-8-(methoxymethoxy)-5,9-dimethylundeca-1,5,9-trien-4-ol |
|---|---|
| PubChem CID | 118517716 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (4S,5E,7S,8R,9E)-7-ethyl-8-(methoxymethoxy)-5,9-dimethylundeca-1,5,9-trien-4-ol |
| SMILES | C=CC[C@H](O)/C(C)=C/[C@H](CC)[C@@H](OCOC)/C(C)=C/C |
| InChI | InChI=1S/C17H30O3/c1-7-10-16(18)14(5)11-15(9-3)17(13(4)8-2)20-12-19-6/h7-8,11,15-18H,1,9-10,12H2,2-6H3/b13-8+,14-11+/t15-,16-,17-/m0/s1 |
| InChIKey | WZHUXSMFEMCUEB-XBZSCPNFSA-N |
| XLogP | 3.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|