C16H26O — CID 11851797
1a,3,3,4,6,6-hexamethyl-5,6a,7,7a-tetrahydro-4H-naphtho[2,3-b]oxirene (PubChem CID 11851797) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 1a,3,3,4,6,6-hexamethyl-5,6a,7,7a-tetrahydro-4H-naphtho[2,3-b]oxirene.
| Compound Name | 1a,3,3,4,6,6-hexamethyl-5,6a,7,7a-tetrahydro-4H-naphtho[2,3-b]oxirene |
|---|---|
| PubChem CID | 11851797 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 1a,3,3,4,6,6-hexamethyl-5,6a,7,7a-tetrahydro-4H-naphtho[2,3-b]oxirene |
| SMILES | CC1CC(C)(C)C2CC3OC3(C)C=C2C1(C)C |
| InChI | InChI=1S/C16H26O/c1-10-8-14(2,3)11-7-13-16(6,17-13)9-12(11)15(10,4)5/h9-11,13H,7-8H2,1-6H3 |
| InChIKey | LIIGCHBQWITAHE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|