C22H29N3O6 — CID 118518338
amino 2-[[6-ethyl-10-hydroxy-9-(3-hydroxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizin-3-yl]methyl-methylamino]acetate (PubChem CID 118518338) has the molecular formula C22H29N3O6 and a molecular weight of 431.49 g/mol. Its IUPAC name is amino 2-[[6-ethyl-10-hydroxy-9-(3-hydroxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizin-3-yl]methyl-methylamino]acetate.
| Compound Name | amino 2-[[6-ethyl-10-hydroxy-9-(3-hydroxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizin-3-yl]methyl-methylamino]acetate |
|---|---|
| PubChem CID | 118518338 |
| Molecular Formula | C22H29N3O6 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | amino 2-[[6-ethyl-10-hydroxy-9-(3-hydroxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizin-3-yl]methyl-methylamino]acetate |
| SMILES | CCC1Cc2cc(OCCCO)c(O)cc2-c2cc(=O)c(CN(C)CC(=O)ON)cn21 |
| InChI | InChI=1S/C22H29N3O6/c1-3-16-7-14-8-21(30-6-4-5-26)20(28)9-17(14)18-10-19(27)15(12-25(16)18)11-24(2)13-22(29)31-23/h8-10,12,16,26,28H,3-7,11,13,23H2,1-2H3 |
| InChIKey | JSHBXYYGOSBFCO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|