About 6-ethyl-N,N-dimethyl-2-azaspiro[3.4]octane-2-carboxamide
6-ethyl-N,N-dimethyl-2-azaspiro[3.4]octane-2-carboxamide (PubChem CID 118518392) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is 6-ethyl-N,N-dimethyl-2-azaspiro[3.4]octane-2-carboxamide.
Molecular Properties
| Compound Name | 6-ethyl-N,N-dimethyl-2-azaspiro[3.4]octane-2-carboxamide |
| PubChem CID | 118518392 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 6-ethyl-N,N-dimethyl-2-azaspiro[3.4]octane-2-carboxamide |
| SMILES | CCC1CCC2(C1)CN(C(=O)N(C)C)C2 |
| InChI | InChI=1S/C12H22N2O/c1-4-10-5-6-12(7-10)8-14(9-12)11(15)13(2)3/h10H,4-9H2,1-3H3 |
| InChIKey | XOYWQODNAQATHY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethyl-N,N-dimethyl-2-azaspiro[3.4]octane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-N,N-dimethyl-2-azaspiro[3.4]octane-2-carboxamide?
The IUPAC name of 6-ethyl-N,N-dimethyl-2-azaspiro[3.4]octane-2-carboxamide (CID 118518392) is 6-ethyl-N,N-dimethyl-2-azaspiro[3.4]octane-2-carboxamide.
What is the SMILES notation for 6-ethyl-N,N-dimethyl-2-azaspiro[3.4]octane-2-carboxamide?
The canonical SMILES for 6-ethyl-N,N-dimethyl-2-azaspiro[3.4]octane-2-carboxamide is CCC1CCC2(C1)CN(C(=O)N(C)C)C2.
What is the InChIKey of 6-ethyl-N,N-dimethyl-2-azaspiro[3.4]octane-2-carboxamide?
The InChIKey is XOYWQODNAQATHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O/c1-4-10-5-6-12(7-10)8-14(9-12)11(15)13(2)3/h10H,4-9H2,1-3H3.
What are the key properties of 6-ethyl-N,N-dimethyl-2-azaspiro[3.4]octane-2-carboxamide?
6-ethyl-N,N-dimethyl-2-azaspiro[3.4]octane-2-carboxamide has a molecular weight of 210.32 g/mol, XLogP of 2.18, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-N,N-dimethyl-2-azaspiro[3.4]octane-2-carboxamide is sourced from PubChem (CID 118518392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).