C47H32N4S — CID 118518536
4-[(3Z,5Z)-7-methylidene-1-phenyl-2H-1-benzazonin-9-yl]-12-(9-phenylcarbazol-3-yl)-8-thia-5,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 118518536) has the molecular formula C47H32N4S and a molecular weight of 684.87 g/mol. Its IUPAC name is 4-[(3Z,5Z)-7-methylidene-1-phenyl-2H-1-benzazonin-9-yl]-12-(9-phenylcarbazol-3-yl)-8-thia-5,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 4-[(3Z,5Z)-7-methylidene-1-phenyl-2H-1-benzazonin-9-yl]-12-(9-phenylcarbazol-3-yl)-8-thia-5,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 118518536 |
| Molecular Formula | C47H32N4S |
| Molecular Weight | 684.87 g/mol |
| Exact Mass | 684.23 |
| IUPAC Name | 4-[(3Z,5Z)-7-methylidene-1-phenyl-2H-1-benzazonin-9-yl]-12-(9-phenylcarbazol-3-yl)-8-thia-5,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | C=C1/C=C\C=C/CN(c2ccccc2)c2ccc(-c3cc4c(cn3)sc3cnc(-c5ccc6c(c5)c5ccccc5n6-c5ccccc5)cc34)cc21 |
| InChI | InChI=1S/C47H32N4S/c1-31-13-5-4-12-24-50(34-14-6-2-7-15-34)43-22-20-32(25-37(31)43)41-27-39-40-28-42(49-30-47(40)52-46(39)29-48-41)33-21-23-45-38(26-33)36-18-10-11-19-44(36)51(45)35-16-8-3-9-17-35/h2-23,25-30H,1,24H2/b12-4-,13-5- |
| InChIKey | FFKADKAXWGVQQD-FQCPIAEUSA-N |
| XLogP | 12.55 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.87 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |