C14H24N2O3 — CID 118518959
[3-[[2-(buta-1,3-dien-2-ylamino)-2-methylpropanoyl]amino]-2,2-dimethylpropyl] formate (PubChem CID 118518959) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is [3-[[2-(buta-1,3-dien-2-ylamino)-2-methylpropanoyl]amino]-2,2-dimethylpropyl] formate.
| Compound Name | [3-[[2-(buta-1,3-dien-2-ylamino)-2-methylpropanoyl]amino]-2,2-dimethylpropyl] formate |
|---|---|
| PubChem CID | 118518959 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | [3-[[2-(buta-1,3-dien-2-ylamino)-2-methylpropanoyl]amino]-2,2-dimethylpropyl] formate |
| SMILES | C=CC(=C)NC(C)(C)C(=O)NCC(C)(C)COC=O |
| InChI | InChI=1S/C14H24N2O3/c1-7-11(2)16-14(5,6)12(18)15-8-13(3,4)9-19-10-17/h7,10,16H,1-2,8-9H2,3-6H3,(H,15,18) |
| InChIKey | TWNLKBRFPWBEIB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|