About (Z)-4-[(3Z)-penta-1,3-dien-3-yl]sulfanylpent-2-ene
(Z)-4-[(3Z)-penta-1,3-dien-3-yl]sulfanylpent-2-ene (PubChem CID 118518974) has the molecular formula C10H16S
and a molecular weight of 168.30 g/mol. Its IUPAC name is (Z)-4-[(3Z)-penta-1,3-dien-3-yl]sulfanylpent-2-ene.
Molecular Properties
| Compound Name | (Z)-4-[(3Z)-penta-1,3-dien-3-yl]sulfanylpent-2-ene |
| PubChem CID | 118518974 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | (Z)-4-[(3Z)-penta-1,3-dien-3-yl]sulfanylpent-2-ene |
| SMILES | C=C/C(=C/C)SC(C)/C=C\C |
| InChI | InChI=1S/C10H16S/c1-5-8-9(4)11-10(6-2)7-3/h5-9H,2H2,1,3-4H3/b8-5-,10-7- |
| InChIKey | FGZTVJJNBFWOOO-OUOSTHCTSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-[(3Z)-penta-1,3-dien-3-yl]sulfanylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-[(3Z)-penta-1,3-dien-3-yl]sulfanylpent-2-ene?
The IUPAC name of (Z)-4-[(3Z)-penta-1,3-dien-3-yl]sulfanylpent-2-ene (CID 118518974) is (Z)-4-[(3Z)-penta-1,3-dien-3-yl]sulfanylpent-2-ene.
What is the SMILES notation for (Z)-4-[(3Z)-penta-1,3-dien-3-yl]sulfanylpent-2-ene?
The canonical SMILES for (Z)-4-[(3Z)-penta-1,3-dien-3-yl]sulfanylpent-2-ene is C=C/C(=C/C)SC(C)/C=C\C.
What is the InChIKey of (Z)-4-[(3Z)-penta-1,3-dien-3-yl]sulfanylpent-2-ene?
The InChIKey is FGZTVJJNBFWOOO-OUOSTHCTSA-N. The full InChI is InChI=1S/C10H16S/c1-5-8-9(4)11-10(6-2)7-3/h5-9H,2H2,1,3-4H3/b8-5-,10-7-.
What are the key properties of (Z)-4-[(3Z)-penta-1,3-dien-3-yl]sulfanylpent-2-ene?
(Z)-4-[(3Z)-penta-1,3-dien-3-yl]sulfanylpent-2-ene has a molecular weight of 168.30 g/mol, XLogP of 3.77, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-[(3Z)-penta-1,3-dien-3-yl]sulfanylpent-2-ene is sourced from PubChem (CID 118518974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).