About (4E)-3-methylidene-7-[[(Z)-pent-3-en-2-yl]amino]hepta-1,4-diene-4-thiol
(4E)-3-methylidene-7-[[(Z)-pent-3-en-2-yl]amino]hepta-1,4-diene-4-thiol (PubChem CID 118518988) has the molecular formula C13H21NS
and a molecular weight of 223.38 g/mol. Its IUPAC name is (4E)-3-methylidene-7-[[(Z)-pent-3-en-2-yl]amino]hepta-1,4-diene-4-thiol.
Molecular Properties
| Compound Name | (4E)-3-methylidene-7-[[(Z)-pent-3-en-2-yl]amino]hepta-1,4-diene-4-thiol |
| PubChem CID | 118518988 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (4E)-3-methylidene-7-[[(Z)-pent-3-en-2-yl]amino]hepta-1,4-diene-4-thiol |
| SMILES | C=CC(=C)/C(S)=C\CCNC(C)/C=C\C |
| InChI | InChI=1S/C13H21NS/c1-5-8-12(4)14-10-7-9-13(15)11(3)6-2/h5-6,8-9,12,14-15H,2-3,7,10H2,1,4H3/b8-5-,13-9+ |
| InChIKey | HAORUEXZTHZDAL-IOVBKEQOSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4E)-3-methylidene-7-[[(Z)-pent-3-en-2-yl]amino]hepta-1,4-diene-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-3-methylidene-7-[[(Z)-pent-3-en-2-yl]amino]hepta-1,4-diene-4-thiol?
The IUPAC name of (4E)-3-methylidene-7-[[(Z)-pent-3-en-2-yl]amino]hepta-1,4-diene-4-thiol (CID 118518988) is (4E)-3-methylidene-7-[[(Z)-pent-3-en-2-yl]amino]hepta-1,4-diene-4-thiol.
What is the SMILES notation for (4E)-3-methylidene-7-[[(Z)-pent-3-en-2-yl]amino]hepta-1,4-diene-4-thiol?
The canonical SMILES for (4E)-3-methylidene-7-[[(Z)-pent-3-en-2-yl]amino]hepta-1,4-diene-4-thiol is C=CC(=C)/C(S)=C\CCNC(C)/C=C\C.
What is the InChIKey of (4E)-3-methylidene-7-[[(Z)-pent-3-en-2-yl]amino]hepta-1,4-diene-4-thiol?
The InChIKey is HAORUEXZTHZDAL-IOVBKEQOSA-N. The full InChI is InChI=1S/C13H21NS/c1-5-8-12(4)14-10-7-9-13(15)11(3)6-2/h5-6,8-9,12,14-15H,2-3,7,10H2,1,4H3/b8-5-,13-9+.
What are the key properties of (4E)-3-methylidene-7-[[(Z)-pent-3-en-2-yl]amino]hepta-1,4-diene-4-thiol?
(4E)-3-methylidene-7-[[(Z)-pent-3-en-2-yl]amino]hepta-1,4-diene-4-thiol has a molecular weight of 223.38 g/mol, XLogP of 3.49, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-3-methylidene-7-[[(Z)-pent-3-en-2-yl]amino]hepta-1,4-diene-4-thiol is sourced from PubChem (CID 118518988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).