About N-ethenyl-N-ethyl-N',2-dimethylbutanimidamide
N-ethenyl-N-ethyl-N',2-dimethylbutanimidamide (PubChem CID 118519253) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is N-ethenyl-N-ethyl-N',2-dimethylbutanimidamide.
Molecular Properties
| Compound Name | N-ethenyl-N-ethyl-N',2-dimethylbutanimidamide |
| PubChem CID | 118519253 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N-ethenyl-N-ethyl-N',2-dimethylbutanimidamide |
| SMILES | C=CN(CC)/C(=N/C)C(C)CC |
| InChI | InChI=1S/C10H20N2/c1-6-9(4)10(11-5)12(7-2)8-3/h7,9H,2,6,8H2,1,3-5H3/b11-10+ |
| InChIKey | MNASRMADBHALBE-ZHACJKMWSA-N |
| XLogP | 2.53 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N-ethyl-N',2-dimethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N-ethyl-N',2-dimethylbutanimidamide?
The IUPAC name of N-ethenyl-N-ethyl-N',2-dimethylbutanimidamide (CID 118519253) is N-ethenyl-N-ethyl-N',2-dimethylbutanimidamide.
What is the SMILES notation for N-ethenyl-N-ethyl-N',2-dimethylbutanimidamide?
The canonical SMILES for N-ethenyl-N-ethyl-N',2-dimethylbutanimidamide is C=CN(CC)/C(=N/C)C(C)CC.
What is the InChIKey of N-ethenyl-N-ethyl-N',2-dimethylbutanimidamide?
The InChIKey is MNASRMADBHALBE-ZHACJKMWSA-N. The full InChI is InChI=1S/C10H20N2/c1-6-9(4)10(11-5)12(7-2)8-3/h7,9H,2,6,8H2,1,3-5H3/b11-10+.
What are the key properties of N-ethenyl-N-ethyl-N',2-dimethylbutanimidamide?
N-ethenyl-N-ethyl-N',2-dimethylbutanimidamide has a molecular weight of 168.28 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N-ethyl-N',2-dimethylbutanimidamide is sourced from PubChem (CID 118519253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).