About (E)-N'-ethylpent-3-enimidamide
(E)-N'-ethylpent-3-enimidamide (PubChem CID 118519265) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is (E)-N'-ethylpent-3-enimidamide.
Molecular Properties
| Compound Name | (E)-N'-ethylpent-3-enimidamide |
| PubChem CID | 118519265 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (E)-N'-ethylpent-3-enimidamide |
| SMILES | C/C=C/C/C(N)=N/CC |
| InChI | InChI=1S/C7H14N2/c1-3-5-6-7(8)9-4-2/h3,5H,4,6H2,1-2H3,(H2,8,9)/b5-3+ |
| InChIKey | UEWSONZUVUPMDG-HWKANZROSA-N |
| XLogP | 1.33 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-ethylpent-3-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-ethylpent-3-enimidamide?
The IUPAC name of (E)-N'-ethylpent-3-enimidamide (CID 118519265) is (E)-N'-ethylpent-3-enimidamide.
What is the SMILES notation for (E)-N'-ethylpent-3-enimidamide?
The canonical SMILES for (E)-N'-ethylpent-3-enimidamide is C/C=C/C/C(N)=N/CC.
What is the InChIKey of (E)-N'-ethylpent-3-enimidamide?
The InChIKey is UEWSONZUVUPMDG-HWKANZROSA-N. The full InChI is InChI=1S/C7H14N2/c1-3-5-6-7(8)9-4-2/h3,5H,4,6H2,1-2H3,(H2,8,9)/b5-3+.
What are the key properties of (E)-N'-ethylpent-3-enimidamide?
(E)-N'-ethylpent-3-enimidamide has a molecular weight of 126.20 g/mol, XLogP of 1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-ethylpent-3-enimidamide is sourced from PubChem (CID 118519265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).