About 2-ethenylidene-1,4-dimethylpiperazine
2-ethenylidene-1,4-dimethylpiperazine (PubChem CID 118519406) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 2-ethenylidene-1,4-dimethylpiperazine.
Molecular Properties
| Compound Name | 2-ethenylidene-1,4-dimethylpiperazine |
| PubChem CID | 118519406 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2-ethenylidene-1,4-dimethylpiperazine |
| SMILES | C=C=C1CN(C)CCN1C |
| InChI | InChI=1S/C8H14N2/c1-4-8-7-9(2)5-6-10(8)3/h1,5-7H2,2-3H3 |
| InChIKey | KOTFKRSECIHJAG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethenylidene-1,4-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylidene-1,4-dimethylpiperazine?
The IUPAC name of 2-ethenylidene-1,4-dimethylpiperazine (CID 118519406) is 2-ethenylidene-1,4-dimethylpiperazine.
What is the SMILES notation for 2-ethenylidene-1,4-dimethylpiperazine?
The canonical SMILES for 2-ethenylidene-1,4-dimethylpiperazine is C=C=C1CN(C)CCN1C.
What is the InChIKey of 2-ethenylidene-1,4-dimethylpiperazine?
The InChIKey is KOTFKRSECIHJAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-4-8-7-9(2)5-6-10(8)3/h1,5-7H2,2-3H3.
What are the key properties of 2-ethenylidene-1,4-dimethylpiperazine?
2-ethenylidene-1,4-dimethylpiperazine has a molecular weight of 138.21 g/mol, XLogP of 0.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylidene-1,4-dimethylpiperazine is sourced from PubChem (CID 118519406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).