C6HBr5O — CID 11852
2,3,4,5,6-pentabromophenol (PubChem CID 11852) has the molecular formula C6HBr5O and a molecular weight of 488.59 g/mol. Its IUPAC name is 2,3,4,5,6-pentabromophenol.
| Compound Name | 2,3,4,5,6-pentabromophenol |
|---|---|
| PubChem CID | 11852 |
| Molecular Formula | C6HBr5O |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 483.59 |
| IUPAC Name | 2,3,4,5,6-pentabromophenol |
| SMILES | Oc1c(Br)c(Br)c(Br)c(Br)c1Br |
| InChI | InChI=1S/C6HBr5O/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
| InChIKey | SVHOVVJFOWGYJO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|