C30H46N4O5S — CID 118520223
S-[(E)-4-[(7S,10S)-3-methyl-5,8,12-trioxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] octanethioate (PubChem CID 118520223) has the molecular formula C30H46N4O5S and a molecular weight of 574.79 g/mol. Its IUPAC name is S-[(E)-4-[(7S,10S)-3-methyl-5,8,12-trioxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] octanethioate.
| Compound Name | S-[(E)-4-[(7S,10S)-3-methyl-5,8,12-trioxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 118520223 |
| Molecular Formula | C30H46N4O5S |
| Molecular Weight | 574.79 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | S-[(E)-4-[(7S,10S)-3-methyl-5,8,12-trioxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C/[C@@H]1CC(=O)NCc2cccc(n2)CN(C)CC(=O)N[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C30H46N4O5S/c1-5-6-7-8-9-16-28(37)40-17-11-10-15-25-18-26(35)31-19-23-13-12-14-24(32-23)20-34(4)21-27(36)33-29(22(2)3)30(38)39-25/h10,12-15,22,25,29H,5-9,11,16-21H2,1-4H3,(H,31,35)(H,33,36)/b15-10+/t25-,29+/m1/s1 |
| InChIKey | PARLWXHRBXLNAG-RQNYSZIMSA-N |
| XLogP | 4.15 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.79 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|