C36H50N4O5S — CID 118520224
S-[(E)-4-[(7S,10S)-3-benzyl-5,8,12-trioxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] octanethioate (PubChem CID 118520224) has the molecular formula C36H50N4O5S and a molecular weight of 650.89 g/mol. Its IUPAC name is S-[(E)-4-[(7S,10S)-3-benzyl-5,8,12-trioxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] octanethioate.
| Compound Name | S-[(E)-4-[(7S,10S)-3-benzyl-5,8,12-trioxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 118520224 |
| Molecular Formula | C36H50N4O5S |
| Molecular Weight | 650.89 g/mol |
| Exact Mass | 650.35 |
| IUPAC Name | S-[(E)-4-[(7S,10S)-3-benzyl-5,8,12-trioxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C/[C@@H]1CC(=O)NCc2cccc(n2)CN(Cc2ccccc2)CC(=O)N[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C36H50N4O5S/c1-4-5-6-7-11-20-34(43)46-21-13-12-19-31-22-32(41)37-23-29-17-14-18-30(38-29)25-40(24-28-15-9-8-10-16-28)26-33(42)39-35(27(2)3)36(44)45-31/h8-10,12,14-19,27,31,35H,4-7,11,13,20-26H2,1-3H3,(H,37,41)(H,39,42)/b19-12+/t31-,35+/m1/s1 |
| InChIKey | GIBFYMMFVGWLOJ-GTUZVPJSSA-N |
| XLogP | 5.72 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.89 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|