C37H52N4O6S — CID 118520226
S-[(E)-4-[(7S,10S)-3-[(4-methoxyphenyl)methyl]-5,8,12-trioxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] octanethioate (PubChem CID 118520226) has the molecular formula C37H52N4O6S and a molecular weight of 680.91 g/mol. Its IUPAC name is S-[(E)-4-[(7S,10S)-3-[(4-methoxyphenyl)methyl]-5,8,12-trioxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] octanethioate.
| Compound Name | S-[(E)-4-[(7S,10S)-3-[(4-methoxyphenyl)methyl]-5,8,12-trioxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 118520226 |
| Molecular Formula | C37H52N4O6S |
| Molecular Weight | 680.91 g/mol |
| Exact Mass | 680.36 |
| IUPAC Name | S-[(E)-4-[(7S,10S)-3-[(4-methoxyphenyl)methyl]-5,8,12-trioxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C/[C@@H]1CC(=O)NCc2cccc(n2)CN(Cc2ccc(OC)cc2)CC(=O)N[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C37H52N4O6S/c1-5-6-7-8-9-16-35(44)48-21-11-10-15-32-22-33(42)38-23-29-13-12-14-30(39-29)25-41(24-28-17-19-31(46-4)20-18-28)26-34(43)40-36(27(2)3)37(45)47-32/h10,12-15,17-20,27,32,36H,5-9,11,16,21-26H2,1-4H3,(H,38,42)(H,40,43)/b15-10+/t32-,36+/m1/s1 |
| InChIKey | NLGAIFKQPUGGBN-CCXBDLSUSA-N |
| XLogP | 5.73 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.91 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|