C26H44N2O7S — CID 118520229
S-[(E)-4-[(3S,16S)-2,5,14-trioxo-3-propan-2-yl-1,7,10-trioxa-4,13-diazacyclohexadec-16-yl]but-3-enyl] octanethioate (PubChem CID 118520229) has the molecular formula C26H44N2O7S and a molecular weight of 528.71 g/mol. Its IUPAC name is S-[(E)-4-[(3S,16S)-2,5,14-trioxo-3-propan-2-yl-1,7,10-trioxa-4,13-diazacyclohexadec-16-yl]but-3-enyl] octanethioate.
| Compound Name | S-[(E)-4-[(3S,16S)-2,5,14-trioxo-3-propan-2-yl-1,7,10-trioxa-4,13-diazacyclohexadec-16-yl]but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 118520229 |
| Molecular Formula | C26H44N2O7S |
| Molecular Weight | 528.71 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | S-[(E)-4-[(3S,16S)-2,5,14-trioxo-3-propan-2-yl-1,7,10-trioxa-4,13-diazacyclohexadec-16-yl]but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C/[C@@H]1CC(=O)NCCOCCOCC(=O)N[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C26H44N2O7S/c1-4-5-6-7-8-12-24(31)36-17-10-9-11-21-18-22(29)27-13-14-33-15-16-34-19-23(30)28-25(20(2)3)26(32)35-21/h9,11,20-21,25H,4-8,10,12-19H2,1-3H3,(H,27,29)(H,28,30)/b11-9+/t21-,25+/m1/s1 |
| InChIKey | XOWCDFPDYHQTMG-WYTIYTFZSA-N |
| XLogP | 3.16 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.71 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|