C18H16F3N3O2 — CID 118520286
12,12,14,14-tetramethyl-5-(trifluoromethyl)-13-oxa-6,10,17-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,8,11(15)-hexaen-16-one (PubChem CID 118520286) has the molecular formula C18H16F3N3O2 and a molecular weight of 363.34 g/mol. Its IUPAC name is 12,12,14,14-tetramethyl-5-(trifluoromethyl)-13-oxa-6,10,17-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,8,11(15)-hexaen-16-one.
| Compound Name | 12,12,14,14-tetramethyl-5-(trifluoromethyl)-13-oxa-6,10,17-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,8,11(15)-hexaen-16-one |
|---|---|
| PubChem CID | 118520286 |
| Molecular Formula | C18H16F3N3O2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 12,12,14,14-tetramethyl-5-(trifluoromethyl)-13-oxa-6,10,17-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,8,11(15)-hexaen-16-one |
| SMILES | CC1(C)OC(C)(C)c2c1c(=O)nc1c3ccc(C(F)(F)F)nc3ccn21 |
| InChI | InChI=1S/C18H16F3N3O2/c1-16(2)12-13(17(3,4)26-16)24-8-7-10-9(14(24)23-15(12)25)5-6-11(22-10)18(19,20)21/h5-8H,1-4H3 |
| InChIKey | RCPPQCGRCLNXIF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|