C23H26N2O4S — CID 11852056
1-methoxy-3-[4-[5-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]-1,2,4-oxadiazol-3-yl]phenoxy]propan-2-ol (PubChem CID 11852056) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is 1-methoxy-3-[4-[5-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]-1,2,4-oxadiazol-3-yl]phenoxy]propan-2-ol.
| Compound Name | 1-methoxy-3-[4-[5-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]-1,2,4-oxadiazol-3-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 11852056 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 1-methoxy-3-[4-[5-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]-1,2,4-oxadiazol-3-yl]phenoxy]propan-2-ol |
| SMILES | COCC(O)COc1ccc(-c2noc(-c3sc(C)c4c3C[C@@H]3[C@H]4C3(C)C)n2)cc1 |
| InChI | InChI=1S/C23H26N2O4S/c1-12-18-16(9-17-19(18)23(17,2)3)20(30-12)22-24-21(25-29-22)13-5-7-15(8-6-13)28-11-14(26)10-27-4/h5-8,14,17,19,26H,9-11H2,1-4H3/t14?,17-,19-/m1/s1 |
| InChIKey | RAFBSLKVUIQFMX-POWSATBFSA-N |
| XLogP | 4.46 |
| TPSA | 77.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |